Fenspiride HCL
Catalog No: FT-0650683
CAS No: 5053-08-7
- Chemical Name: Fenspiride HCL
- Molecular Formula: C15H21ClN2O2
- Molecular Weight: 296.79
- InChI Key: FIKFLLIUPUVONI-UHFFFAOYSA-N
- InChI: InChI=1S/C15H20N2O2.ClH/c18-14-16-12-15(19-14)7-10-17(11-8-15)9-6-13-4-2-1-3-5-13;/h1-5H,6-12H2,(H,16,18);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 5053-08-7 |
| Flash_Point: | 240.6ºC |
| Product_Name: | fenspiride hydrochloride |
| Bolling_Point: | 474.3ºC at 760mmHg |
| FW: | 296.79200 |
| Melting_Point: | 235-238ºC (dec.) |
| MF: | C15H21ClN2O2 |
| Density: | 1.19g/cm3 |
| Melting_Point: | 235-238ºC (dec.) |
|---|---|
| MF: | C15H21ClN2O2 |
| Flash_Point: | 240.6ºC |
| LogP: | 2.87220 |
| FW: | 296.79200 |
| Density: | 1.19g/cm3 |
| PSA: | 41.57000 |
| Bolling_Point: | 474.3ºC at 760mmHg |
| Exact_Mass: | 296.12900 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | 20/21/22 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RTECS: | RO0375000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn |
| Warning_Statement: | P280 |
| Safety_Statements: | H302-H312-H332 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)